C12H15N3O3S — CID 90927012
(2R)-2-methyl-N-(2-nitrophenyl)sulfanylpyrrolidine-1-carboxamide (PubChem CID 90927012) has the molecular formula C12H15N3O3S and a molecular weight of 281.34 g/mol. Its IUPAC name is (2R)-2-methyl-N-(2-nitrophenyl)sulfanylpyrrolidine-1-carboxamide.
| Compound Name | (2R)-2-methyl-N-(2-nitrophenyl)sulfanylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 90927012 |
| Molecular Formula | C12H15N3O3S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | (2R)-2-methyl-N-(2-nitrophenyl)sulfanylpyrrolidine-1-carboxamide |
| SMILES | C[C@@H]1CCCN1C(=O)NSc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H15N3O3S/c1-9-5-4-8-14(9)12(16)13-19-11-7-3-2-6-10(11)15(17)18/h2-3,6-7,9H,4-5,8H2,1H3,(H,13,16)/t9-/m1/s1 |
| InChIKey | PYIDRFVIFSXOLZ-SECBINFHSA-N |
| XLogP | 2.80 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|