C25H24N2O7S — CID 89246773
methyl (4S)-2-(2,4-dimethoxyphenyl)-3-(2-nitrophenyl)sulfanyl-4-phenyl-1,3-oxazolidine-5-carboxylate (PubChem CID 89246773) has the molecular formula C25H24N2O7S and a molecular weight of 496.54 g/mol. Its IUPAC name is methyl (4S)-2-(2,4-dimethoxyphenyl)-3-(2-nitrophenyl)sulfanyl-4-phenyl-1,3-oxazolidine-5-carboxylate.
| Compound Name | methyl (4S)-2-(2,4-dimethoxyphenyl)-3-(2-nitrophenyl)sulfanyl-4-phenyl-1,3-oxazolidine-5-carboxylate |
|---|---|
| PubChem CID | 89246773 |
| Molecular Formula | C25H24N2O7S |
| Molecular Weight | 496.54 g/mol |
| Exact Mass | 496.13 |
| IUPAC Name | methyl (4S)-2-(2,4-dimethoxyphenyl)-3-(2-nitrophenyl)sulfanyl-4-phenyl-1,3-oxazolidine-5-carboxylate |
| SMILES | COC(=O)C1OC(c2ccc(OC)cc2OC)N(Sc2ccccc2[N+](=O)[O-])[C@H]1c1ccccc1 |
| InChI | InChI=1S/C25H24N2O7S/c1-31-17-13-14-18(20(15-17)32-2)24-26(35-21-12-8-7-11-19(21)27(29)30)22(16-9-5-4-6-10-16)23(34-24)25(28)33-3/h4-15,22-24H,1-3H3/t22-,23?,24?/m0/s1 |
| InChIKey | BOQAZOIBDUABAD-BOMBAVFCSA-N |
| XLogP | 4.93 |
| TPSA | 100.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.54 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|