C26H24N2O7 — CID 10128261
(2Z,4S,5R)-2-[(2,4-dimethoxyphenyl)methylidene]-3-[(2-nitrophenyl)methyl]-4-phenyl-1,3-oxazolidine-5-carboxylic acid (PubChem CID 10128261) has the molecular formula C26H24N2O7 and a molecular weight of 476.49 g/mol. Its IUPAC name is (2Z,4S,5R)-2-[(2,4-dimethoxyphenyl)methylidene]-3-[(2-nitrophenyl)methyl]-4-phenyl-1,3-oxazolidine-5-carboxylic acid.
| Compound Name | (2Z,4S,5R)-2-[(2,4-dimethoxyphenyl)methylidene]-3-[(2-nitrophenyl)methyl]-4-phenyl-1,3-oxazolidine-5-carboxylic acid |
|---|---|
| PubChem CID | 10128261 |
| Molecular Formula | C26H24N2O7 |
| Molecular Weight | 476.49 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | (2Z,4S,5R)-2-[(2,4-dimethoxyphenyl)methylidene]-3-[(2-nitrophenyl)methyl]-4-phenyl-1,3-oxazolidine-5-carboxylic acid |
| SMILES | COc1ccc(/C=C2\O[C@@H](C(=O)O)[C@H](c3ccccc3)N2Cc2ccccc2[N+](=O)[O-])c(OC)c1 |
| InChI | InChI=1S/C26H24N2O7/c1-33-20-13-12-18(22(15-20)34-2)14-23-27(16-19-10-6-7-11-21(19)28(31)32)24(25(35-23)26(29)30)17-8-4-3-5-9-17/h3-15,24-25H,16H2,1-2H3,(H,29,30)/b23-14-/t24-,25+/m0/s1 |
| InChIKey | HQCYTTZRZPLRMJ-GFRYGOHHSA-N |
| XLogP | 4.64 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.49 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|