C28H21N3O3S2 — CID 15836821
[(2Z,4S,5R)-2-(2-nitrophenyl)sulfanylimino-3,4-diphenyl-1,3-thiazolidin-5-yl]-phenylmethanone (PubChem CID 15836821) has the molecular formula C28H21N3O3S2 and a molecular weight of 511.63 g/mol. Its IUPAC name is [(2Z,4S,5R)-2-(2-nitrophenyl)sulfanylimino-3,4-diphenyl-1,3-thiazolidin-5-yl]-phenylmethanone.
| Compound Name | [(2Z,4S,5R)-2-(2-nitrophenyl)sulfanylimino-3,4-diphenyl-1,3-thiazolidin-5-yl]-phenylmethanone |
|---|---|
| PubChem CID | 15836821 |
| Molecular Formula | C28H21N3O3S2 |
| Molecular Weight | 511.63 g/mol |
| Exact Mass | 511.10 |
| IUPAC Name | [(2Z,4S,5R)-2-(2-nitrophenyl)sulfanylimino-3,4-diphenyl-1,3-thiazolidin-5-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)[C@@H]1S/C(=N\Sc2ccccc2[N+](=O)[O-])N(c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C28H21N3O3S2/c32-26(21-14-6-2-7-15-21)27-25(20-12-4-1-5-13-20)30(22-16-8-3-9-17-22)28(35-27)29-36-24-19-11-10-18-23(24)31(33)34/h1-19,25,27H/b29-28-/t25-,27+/m0/s1 |
| InChIKey | SYNLLGULQCZFGV-ARIWRIQGSA-N |
| XLogP | 7.20 |
| TPSA | 75.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.63 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|