C19H17NO4S — CID 3453061
2-benzoyl-6-(2-nitrophenyl)sulfanylcyclohexan-1-one (PubChem CID 3453061) has the molecular formula C19H17NO4S and a molecular weight of 355.42 g/mol. Its IUPAC name is 2-benzoyl-6-(2-nitrophenyl)sulfanylcyclohexan-1-one.
| Compound Name | 2-benzoyl-6-(2-nitrophenyl)sulfanylcyclohexan-1-one |
|---|---|
| PubChem CID | 3453061 |
| Molecular Formula | C19H17NO4S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 2-benzoyl-6-(2-nitrophenyl)sulfanylcyclohexan-1-one |
| SMILES | O=C(c1ccccc1)C1CCCC(Sc2ccccc2[N+](=O)[O-])C1=O |
| InChI | InChI=1S/C19H17NO4S/c21-18(13-7-2-1-3-8-13)14-9-6-12-17(19(14)22)25-16-11-5-4-10-15(16)20(23)24/h1-5,7-8,10-11,14,17H,6,9,12H2 |
| InChIKey | GTDHNSRJYJDPCM-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|