C14H18ClNO2S — CID 682620
cis-(1S,2R)-1-chloro-2-(2-nitrophenyl)sulfanylcyclooctane (PubChem CID 682620) has the molecular formula C14H18ClNO2S and a molecular weight of 299.82 g/mol. Its IUPAC name is cis-(1S,2R)-1-chloro-2-(2-nitrophenyl)sulfanylcyclooctane.
| Compound Name | cis-(1S,2R)-1-chloro-2-(2-nitrophenyl)sulfanylcyclooctane |
|---|---|
| PubChem CID | 682620 |
| Molecular Formula | C14H18ClNO2S |
| Molecular Weight | 299.82 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | cis-(1S,2R)-1-chloro-2-(2-nitrophenyl)sulfanylcyclooctane |
| SMILES | O=[N+]([O-])c1ccccc1S[C@@H]1CCCCCC[C@@H]1Cl |
| InChI | InChI=1S/C14H18ClNO2S/c15-11-7-3-1-2-4-9-13(11)19-14-10-6-5-8-12(14)16(17)18/h5-6,8,10-11,13H,1-4,7,9H2/t11-,13+/m0/s1 |
| InChIKey | YVSQTCRGDPZBIR-WCQYABFASA-N |
| XLogP | 5.02 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.82 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|