C13H13NO3S — CID 13110656
(1R,3S,4S,5R)-5-(2-nitrophenyl)sulfanyltricyclo[2.2.1.02,6]heptan-3-ol (PubChem CID 13110656) has the molecular formula C13H13NO3S and a molecular weight of 263.32 g/mol. Its IUPAC name is (1R,3S,4S,5R)-5-(2-nitrophenyl)sulfanyltricyclo[2.2.1.02,6]heptan-3-ol.
| Compound Name | (1R,3S,4S,5R)-5-(2-nitrophenyl)sulfanyltricyclo[2.2.1.02,6]heptan-3-ol |
|---|---|
| PubChem CID | 13110656 |
| Molecular Formula | C13H13NO3S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | (1R,3S,4S,5R)-5-(2-nitrophenyl)sulfanyltricyclo[2.2.1.02,6]heptan-3-ol |
| SMILES | O=[N+]([O-])c1ccccc1SC1C2C3C(O)[C@@H]1C[C@H]32 |
| InChI | InChI=1S/C13H13NO3S/c15-12-7-5-6-10(12)11(6)13(7)18-9-4-2-1-3-8(9)14(16)17/h1-4,6-7,10-13,15H,5H2/t6-,7+,10?,11?,12?,13?/m1/s1 |
| InChIKey | CSSUPHHORWKRIW-NBFVOJFESA-N |
| XLogP | 2.31 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|