C27H20ClNO3S — CID 15417660
(1S,7R,8R,10S)-8-chloro-10-(2-nitrophenyl)sulfanyl-3,5-diphenyl-4-oxatricyclo[5.2.1.02,6]deca-2,5-diene (PubChem CID 15417660) has the molecular formula C27H20ClNO3S and a molecular weight of 473.98 g/mol. Its IUPAC name is (1S,7R,8R,10S)-8-chloro-10-(2-nitrophenyl)sulfanyl-3,5-diphenyl-4-oxatricyclo[5.2.1.02,6]deca-2,5-diene.
| Compound Name | (1S,7R,8R,10S)-8-chloro-10-(2-nitrophenyl)sulfanyl-3,5-diphenyl-4-oxatricyclo[5.2.1.02,6]deca-2,5-diene |
|---|---|
| PubChem CID | 15417660 |
| Molecular Formula | C27H20ClNO3S |
| Molecular Weight | 473.98 g/mol |
| Exact Mass | 473.09 |
| IUPAC Name | (1S,7R,8R,10S)-8-chloro-10-(2-nitrophenyl)sulfanyl-3,5-diphenyl-4-oxatricyclo[5.2.1.02,6]deca-2,5-diene |
| SMILES | O=[N+]([O-])c1ccccc1S[C@@H]1[C@H]2c3c(-c4ccccc4)oc(-c4ccccc4)c3[C@@H]1C[C@H]2Cl |
| InChI | InChI=1S/C27H20ClNO3S/c28-19-15-18-22-24(23(19)27(18)33-21-14-8-7-13-20(21)29(30)31)26(17-11-5-2-6-12-17)32-25(22)16-9-3-1-4-10-16/h1-14,18-19,23,27H,15H2/t18-,19+,23+,27-/m0/s1 |
| InChIKey | LRDGAYVDNPMNOI-JVRGUZJSSA-N |
| XLogP | 7.87 |
| TPSA | 56.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.98 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|