C22H22ClN3O6S — CID 11917955
(1R,2S,3aR,4R,9bS)-1-chloro-9-nitro-2-(2-nitrophenyl)sulfanyl-4-propyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-6-carboxylic acid (PubChem CID 11917955) has the molecular formula C22H22ClN3O6S and a molecular weight of 491.95 g/mol. Its IUPAC name is (1R,2S,3aR,4R,9bS)-1-chloro-9-nitro-2-(2-nitrophenyl)sulfanyl-4-propyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-6-carboxylic acid.
| Compound Name | (1R,2S,3aR,4R,9bS)-1-chloro-9-nitro-2-(2-nitrophenyl)sulfanyl-4-propyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-6-carboxylic acid |
|---|---|
| PubChem CID | 11917955 |
| Molecular Formula | C22H22ClN3O6S |
| Molecular Weight | 491.95 g/mol |
| Exact Mass | 491.09 |
| IUPAC Name | (1R,2S,3aR,4R,9bS)-1-chloro-9-nitro-2-(2-nitrophenyl)sulfanyl-4-propyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-6-carboxylic acid |
| SMILES | CCC[C@H]1Nc2c(C(=O)O)ccc([N+](=O)[O-])c2[C@H]2[C@@H](Cl)[C@@H](Sc3ccccc3[N+](=O)[O-])C[C@H]21 |
| InChI | InChI=1S/C22H22ClN3O6S/c1-2-5-13-12-10-17(33-16-7-4-3-6-14(16)25(29)30)20(23)18(12)19-15(26(31)32)9-8-11(22(27)28)21(19)24-13/h3-4,6-9,12-13,17-18,20,24H,2,5,10H2,1H3,(H,27,28)/t12-,13+,17-,18-,20-/m0/s1 |
| InChIKey | COGRKLXBUHSTNJ-NNOFZCPDSA-N |
| XLogP | 5.67 |
| TPSA | 135.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.95 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|