C20H18ClN3O6S — CID 124766467
(1S,2S,3aR,4S,9bR)-1-chloro-4-methyl-9-nitro-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-6-carboxylic acid (PubChem CID 124766467) has the molecular formula C20H18ClN3O6S and a molecular weight of 463.90 g/mol. Its IUPAC name is (1S,2S,3aR,4S,9bR)-1-chloro-4-methyl-9-nitro-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-6-carboxylic acid.
| Compound Name | (1S,2S,3aR,4S,9bR)-1-chloro-4-methyl-9-nitro-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-6-carboxylic acid |
|---|---|
| PubChem CID | 124766467 |
| Molecular Formula | C20H18ClN3O6S |
| Molecular Weight | 463.90 g/mol |
| Exact Mass | 463.06 |
| IUPAC Name | (1S,2S,3aR,4S,9bR)-1-chloro-4-methyl-9-nitro-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-6-carboxylic acid |
| SMILES | C[C@@H]1Nc2c(C(=O)O)ccc([N+](=O)[O-])c2[C@@H]2[C@H](Cl)[C@@H](Sc3ccccc3[N+](=O)[O-])C[C@H]21 |
| InChI | InChI=1S/C20H18ClN3O6S/c1-9-11-8-15(31-14-5-3-2-4-12(14)23(27)28)18(21)16(11)17-13(24(29)30)7-6-10(20(25)26)19(17)22-9/h2-7,9,11,15-16,18,22H,8H2,1H3,(H,25,26)/t9-,11-,15-,16+,18+/m0/s1 |
| InChIKey | CJIRCQLSUKSMNK-JAGIBUSNSA-N |
| XLogP | 4.89 |
| TPSA | 135.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.90 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|