C25H21ClN2O4S — CID 98172829
(1S,2R,3aR,4S,9bR)-1-chloro-2-(2-nitrophenyl)sulfanyl-4-phenyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-8-carboxylic acid (PubChem CID 98172829) has the molecular formula C25H21ClN2O4S and a molecular weight of 480.97 g/mol. Its IUPAC name is (1S,2R,3aR,4S,9bR)-1-chloro-2-(2-nitrophenyl)sulfanyl-4-phenyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-8-carboxylic acid.
| Compound Name | (1S,2R,3aR,4S,9bR)-1-chloro-2-(2-nitrophenyl)sulfanyl-4-phenyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-8-carboxylic acid |
|---|---|
| PubChem CID | 98172829 |
| Molecular Formula | C25H21ClN2O4S |
| Molecular Weight | 480.97 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | (1S,2R,3aR,4S,9bR)-1-chloro-2-(2-nitrophenyl)sulfanyl-4-phenyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-8-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)[C@@H]1[C@H](Cl)[C@H](Sc3ccccc3[N+](=O)[O-])C[C@H]1[C@@H](c1ccccc1)N2 |
| InChI | InChI=1S/C25H21ClN2O4S/c26-23-21(33-20-9-5-4-8-19(20)28(31)32)13-17-22(23)16-12-15(25(29)30)10-11-18(16)27-24(17)14-6-2-1-3-7-14/h1-12,17,21-24,27H,13H2,(H,29,30)/t17-,21-,22+,23-,24-/m1/s1 |
| InChIKey | GEQGUCRYYIPLPX-ASDZUOGYSA-N |
| XLogP | 6.33 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.97 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|