C30H25ClN2O3S — CID 100876668
1-[(1S,2R,3aR,4S,9bR)-1-chloro-4-naphthalen-1-yl-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-8-yl]ethanone (PubChem CID 100876668) has the molecular formula C30H25ClN2O3S and a molecular weight of 529.06 g/mol. Its IUPAC name is 1-[(1S,2R,3aR,4S,9bR)-1-chloro-4-naphthalen-1-yl-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-8-yl]ethanone.
| Compound Name | 1-[(1S,2R,3aR,4S,9bR)-1-chloro-4-naphthalen-1-yl-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-8-yl]ethanone |
|---|---|
| PubChem CID | 100876668 |
| Molecular Formula | C30H25ClN2O3S |
| Molecular Weight | 529.06 g/mol |
| Exact Mass | 528.13 |
| IUPAC Name | 1-[(1S,2R,3aR,4S,9bR)-1-chloro-4-naphthalen-1-yl-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-8-yl]ethanone |
| SMILES | CC(=O)c1ccc2c(c1)[C@@H]1[C@H](Cl)[C@H](Sc3ccccc3[N+](=O)[O-])C[C@H]1[C@@H](c1cccc3ccccc13)N2 |
| InChI | InChI=1S/C30H25ClN2O3S/c1-17(34)19-13-14-24-22(15-19)28-23(30(32-24)21-10-6-8-18-7-2-3-9-20(18)21)16-27(29(28)31)37-26-12-5-4-11-25(26)33(35)36/h2-15,23,27-30,32H,16H2,1H3/t23-,27-,28+,29-,30-/m1/s1 |
| InChIKey | HATBGVIBXSBWJO-VLYBHXKQSA-N |
| XLogP | 7.99 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.06 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|