C21H18ClN2O5S- — CID 11917926
(1R,2S,3aR,4R,9bS)-8-acetyl-1-chloro-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-4-carboxylate (PubChem CID 11917926) has the molecular formula C21H18ClN2O5S- and a molecular weight of 445.90 g/mol. Its IUPAC name is (1R,2S,3aR,4R,9bS)-8-acetyl-1-chloro-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-4-carboxylate.
| Compound Name | (1R,2S,3aR,4R,9bS)-8-acetyl-1-chloro-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 11917926 |
| Molecular Formula | C21H18ClN2O5S- |
| Molecular Weight | 445.90 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | (1R,2S,3aR,4R,9bS)-8-acetyl-1-chloro-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-4-carboxylate |
| SMILES | CC(=O)c1ccc2c(c1)[C@H]1[C@@H](Cl)[C@@H](Sc3ccccc3[N+](=O)[O-])C[C@H]1[C@H](C(=O)[O-])N2 |
| InChI | InChI=1S/C21H19ClN2O5S/c1-10(25)11-6-7-14-12(8-11)18-13(20(23-14)21(26)27)9-17(19(18)22)30-16-5-3-2-4-15(16)24(28)29/h2-8,13,17-20,23H,9H2,1H3,(H,26,27)/p-1/t13-,17+,18-,19+,20-/m1/s1 |
| InChIKey | HFXTYQITEZRVMW-FZIGORSYSA-M |
| XLogP | 3.21 |
| TPSA | 112.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.90 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|