C25H21ClN2O5S — CID 5192983
1-chloro-2-(2-nitrophenyl)sulfanyl-8-phenoxy-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-4-carboxylic acid (PubChem CID 5192983) has the molecular formula C25H21ClN2O5S and a molecular weight of 496.97 g/mol. Its IUPAC name is 1-chloro-2-(2-nitrophenyl)sulfanyl-8-phenoxy-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-4-carboxylic acid.
| Compound Name | 1-chloro-2-(2-nitrophenyl)sulfanyl-8-phenoxy-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 5192983 |
| Molecular Formula | C25H21ClN2O5S |
| Molecular Weight | 496.97 g/mol |
| Exact Mass | 496.09 |
| IUPAC Name | 1-chloro-2-(2-nitrophenyl)sulfanyl-8-phenoxy-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-4-carboxylic acid |
| SMILES | O=C(O)C1Nc2ccc(Oc3ccccc3)cc2C2C(Cl)C(Sc3ccccc3[N+](=O)[O-])CC12 |
| InChI | InChI=1S/C25H21ClN2O5S/c26-23-21(34-20-9-5-4-8-19(20)28(31)32)13-17-22(23)16-12-15(33-14-6-2-1-3-7-14)10-11-18(16)27-24(17)25(29)30/h1-12,17,21-24,27H,13H2,(H,29,30) |
| InChIKey | QICYUDVFYQEDQH-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.97 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|