C26H28ClN3O5S — CID 100879078
(1S,2R,3aR,4R,9bR)-1-chloro-8-[(2R)-2-methylpiperidine-1-carbonyl]-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-4-carboxylic acid (PubChem CID 100879078) has the molecular formula C26H28ClN3O5S and a molecular weight of 530.05 g/mol. Its IUPAC name is (1S,2R,3aR,4R,9bR)-1-chloro-8-[(2R)-2-methylpiperidine-1-carbonyl]-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-4-carboxylic acid.
| Compound Name | (1S,2R,3aR,4R,9bR)-1-chloro-8-[(2R)-2-methylpiperidine-1-carbonyl]-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 100879078 |
| Molecular Formula | C26H28ClN3O5S |
| Molecular Weight | 530.05 g/mol |
| Exact Mass | 529.14 |
| IUPAC Name | (1S,2R,3aR,4R,9bR)-1-chloro-8-[(2R)-2-methylpiperidine-1-carbonyl]-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-4-carboxylic acid |
| SMILES | C[C@@H]1CCCCN1C(=O)c1ccc2c(c1)[C@@H]1[C@H](Cl)[C@H](Sc3ccccc3[N+](=O)[O-])C[C@H]1[C@H](C(=O)O)N2 |
| InChI | InChI=1S/C26H28ClN3O5S/c1-14-6-4-5-11-29(14)25(31)15-9-10-18-16(12-15)22-17(24(28-18)26(32)33)13-21(23(22)27)36-20-8-3-2-7-19(20)30(34)35/h2-3,7-10,12,14,17,21-24,28H,4-6,11,13H2,1H3,(H,32,33)/t14-,17-,21-,22+,23-,24-/m1/s1 |
| InChIKey | CNUOJWXPQWZPJF-BXABTIEQSA-N |
| XLogP | 5.36 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.05 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|