C26H21Cl3N2O3S — CID 98342671
1-[(1R,2S,3aS,4S,9bS)-1-chloro-4-(2,4-dichlorophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-8-yl]ethanone (PubChem CID 98342671) has the molecular formula C26H21Cl3N2O3S and a molecular weight of 547.89 g/mol. Its IUPAC name is 1-[(1R,2S,3aS,4S,9bS)-1-chloro-4-(2,4-dichlorophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-8-yl]ethanone.
| Compound Name | 1-[(1R,2S,3aS,4S,9bS)-1-chloro-4-(2,4-dichlorophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-8-yl]ethanone |
|---|---|
| PubChem CID | 98342671 |
| Molecular Formula | C26H21Cl3N2O3S |
| Molecular Weight | 547.89 g/mol |
| Exact Mass | 546.03 |
| IUPAC Name | 1-[(1R,2S,3aS,4S,9bS)-1-chloro-4-(2,4-dichlorophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-8-yl]ethanone |
| SMILES | CC(=O)c1ccc2c(c1)[C@H]1[C@@H](Cl)[C@@H](Sc3ccccc3[N+](=O)[O-])C[C@@H]1[C@@H](c1ccc(Cl)cc1Cl)N2 |
| InChI | InChI=1S/C26H21Cl3N2O3S/c1-13(32)14-6-9-20-17(10-14)24-18(26(30-20)16-8-7-15(27)11-19(16)28)12-23(25(24)29)35-22-5-3-2-4-21(22)31(33)34/h2-11,18,23-26,30H,12H2,1H3/t18-,23-,24+,25-,26+/m0/s1 |
| InChIKey | XMQITQVBHLNMNB-LOULNAIUSA-N |
| XLogP | 8.14 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.89 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|