C31H22Cl4N2O3S — CID 124774571
[(1R,2S,3aR,4S,9bS)-1,8-dichloro-4-(2,4-dichlorophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-6-yl]-phenylmethanone (PubChem CID 124774571) has the molecular formula C31H22Cl4N2O3S and a molecular weight of 644.41 g/mol. Its IUPAC name is [(1R,2S,3aR,4S,9bS)-1,8-dichloro-4-(2,4-dichlorophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-6-yl]-phenylmethanone.
| Compound Name | [(1R,2S,3aR,4S,9bS)-1,8-dichloro-4-(2,4-dichlorophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-6-yl]-phenylmethanone |
|---|---|
| PubChem CID | 124774571 |
| Molecular Formula | C31H22Cl4N2O3S |
| Molecular Weight | 644.41 g/mol |
| Exact Mass | 642.01 |
| IUPAC Name | [(1R,2S,3aR,4S,9bS)-1,8-dichloro-4-(2,4-dichlorophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-6-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1cc(Cl)cc2c1N[C@H](c1ccc(Cl)cc1Cl)[C@@H]1C[C@H](Sc3ccccc3[N+](=O)[O-])[C@H](Cl)[C@H]21 |
| InChI | InChI=1S/C31H22Cl4N2O3S/c32-17-10-11-19(23(34)14-17)29-21-15-26(41-25-9-5-4-8-24(25)37(39)40)28(35)27(21)20-12-18(33)13-22(30(20)36-29)31(38)16-6-2-1-3-7-16/h1-14,21,26-29,36H,15H2/t21-,26+,27-,28+,29-/m1/s1 |
| InChIKey | HVEKKIFYJCDJLJ-NKWMDNGJSA-N |
| XLogP | 9.82 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.41 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|