C24H18Cl4N2O2S — CID 11946599
(1S,2R,3aR,4S,9bR)-1,6-dichloro-4-(2,3-dichlorophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline (PubChem CID 11946599) has the molecular formula C24H18Cl4N2O2S and a molecular weight of 540.30 g/mol. Its IUPAC name is (1S,2R,3aR,4S,9bR)-1,6-dichloro-4-(2,3-dichlorophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline.
| Compound Name | (1S,2R,3aR,4S,9bR)-1,6-dichloro-4-(2,3-dichlorophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 11946599 |
| Molecular Formula | C24H18Cl4N2O2S |
| Molecular Weight | 540.30 g/mol |
| Exact Mass | 537.98 |
| IUPAC Name | (1S,2R,3aR,4S,9bR)-1,6-dichloro-4-(2,3-dichlorophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline |
| SMILES | O=[N+]([O-])c1ccccc1S[C@@H]1C[C@@H]2[C@H](c3cccc(Cl)c3N[C@@H]2c2cccc(Cl)c2Cl)[C@@H]1Cl |
| InChI | InChI=1S/C24H18Cl4N2O2S/c25-15-7-4-6-13(21(15)27)23-14-11-19(33-18-10-2-1-9-17(18)30(31)32)22(28)20(14)12-5-3-8-16(26)24(12)29-23/h1-10,14,19-20,22-23,29H,11H2/t14-,19-,20+,22-,23-/m1/s1 |
| InChIKey | PETWMMKMJJBZEY-ZHRSSXLWSA-N |
| XLogP | 8.59 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.30 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|