C25H20Cl3N3O5S — CID 3120376
1-chloro-4-(2,3-dichlorophenyl)-6-methoxy-8-nitro-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline (PubChem CID 3120376) has the molecular formula C25H20Cl3N3O5S and a molecular weight of 580.88 g/mol. Its IUPAC name is 1-chloro-4-(2,3-dichlorophenyl)-6-methoxy-8-nitro-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline.
| Compound Name | 1-chloro-4-(2,3-dichlorophenyl)-6-methoxy-8-nitro-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 3120376 |
| Molecular Formula | C25H20Cl3N3O5S |
| Molecular Weight | 580.88 g/mol |
| Exact Mass | 579.02 |
| IUPAC Name | 1-chloro-4-(2,3-dichlorophenyl)-6-methoxy-8-nitro-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline |
| SMILES | COc1cc([N+](=O)[O-])cc2c1NC(c1cccc(Cl)c1Cl)C1CC(Sc3ccccc3[N+](=O)[O-])C(Cl)C21 |
| InChI | InChI=1S/C25H20Cl3N3O5S/c1-36-18-10-12(30(32)33)9-14-21-15(24(29-25(14)18)13-5-4-6-16(26)22(13)27)11-20(23(21)28)37-19-8-3-2-7-17(19)31(34)35/h2-10,15,20-21,23-24,29H,11H2,1H3 |
| InChIKey | WSVGRSLQYIDBPC-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 107.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.88 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|