C25H21BrClN3O5S — CID 11918330
(1S,2R,3aS,4R,9bS)-4-(4-bromophenyl)-1-chloro-6-methoxy-8-nitro-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline (PubChem CID 11918330) has the molecular formula C25H21BrClN3O5S and a molecular weight of 590.88 g/mol. Its IUPAC name is (1S,2R,3aS,4R,9bS)-4-(4-bromophenyl)-1-chloro-6-methoxy-8-nitro-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline.
| Compound Name | (1S,2R,3aS,4R,9bS)-4-(4-bromophenyl)-1-chloro-6-methoxy-8-nitro-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 11918330 |
| Molecular Formula | C25H21BrClN3O5S |
| Molecular Weight | 590.88 g/mol |
| Exact Mass | 589.01 |
| IUPAC Name | (1S,2R,3aS,4R,9bS)-4-(4-bromophenyl)-1-chloro-6-methoxy-8-nitro-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline |
| SMILES | COc1cc([N+](=O)[O-])cc2c1N[C@@H](c1ccc(Br)cc1)[C@H]1C[C@@H](Sc3ccccc3[N+](=O)[O-])[C@@H](Cl)[C@H]21 |
| InChI | InChI=1S/C25H21BrClN3O5S/c1-35-19-11-15(29(31)32)10-16-22-17(24(28-25(16)19)13-6-8-14(26)9-7-13)12-21(23(22)27)36-20-5-3-2-4-18(20)30(33)34/h2-11,17,21-24,28H,12H2,1H3/t17-,21+,22+,23+,24-/m0/s1 |
| InChIKey | QWYTWCUOTIWUPQ-QNBQWMASSA-N |
| XLogP | 7.31 |
| TPSA | 107.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.88 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|