C31H23BrCl2N2O3S — CID 3906864
[4-(4-bromophenyl)-1,8-dichloro-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-6-yl]-phenylmethanone (PubChem CID 3906864) has the molecular formula C31H23BrCl2N2O3S and a molecular weight of 654.41 g/mol. Its IUPAC name is [4-(4-bromophenyl)-1,8-dichloro-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-6-yl]-phenylmethanone.
| Compound Name | [4-(4-bromophenyl)-1,8-dichloro-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-6-yl]-phenylmethanone |
|---|---|
| PubChem CID | 3906864 |
| Molecular Formula | C31H23BrCl2N2O3S |
| Molecular Weight | 654.41 g/mol |
| Exact Mass | 652.00 |
| IUPAC Name | [4-(4-bromophenyl)-1,8-dichloro-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-6-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1cc(Cl)cc2c1NC(c1ccc(Br)cc1)C1CC(Sc3ccccc3[N+](=O)[O-])C(Cl)C21 |
| InChI | InChI=1S/C31H23BrCl2N2O3S/c32-19-12-10-17(11-13-19)29-22-16-26(40-25-9-5-4-8-24(25)36(38)39)28(34)27(22)21-14-20(33)15-23(30(21)35-29)31(37)18-6-2-1-3-7-18/h1-15,22,26-29,35H,16H2 |
| InChIKey | VPRSOPJUGOXLRT-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.41 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|