C24H19Cl2FN2O2S — CID 51451332
(1S,2S,3aS,4R,9bR)-1,8-dichloro-4-(4-fluorophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline (PubChem CID 51451332) has the molecular formula C24H19Cl2FN2O2S and a molecular weight of 489.40 g/mol. Its IUPAC name is (1S,2S,3aS,4R,9bR)-1,8-dichloro-4-(4-fluorophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline.
| Compound Name | (1S,2S,3aS,4R,9bR)-1,8-dichloro-4-(4-fluorophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 51451332 |
| Molecular Formula | C24H19Cl2FN2O2S |
| Molecular Weight | 489.40 g/mol |
| Exact Mass | 488.05 |
| IUPAC Name | (1S,2S,3aS,4R,9bR)-1,8-dichloro-4-(4-fluorophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline |
| SMILES | O=[N+]([O-])c1ccccc1S[C@H]1C[C@H]2[C@H](c3cc(Cl)ccc3N[C@H]2c2ccc(F)cc2)[C@@H]1Cl |
| InChI | InChI=1S/C24H19Cl2FN2O2S/c25-14-7-10-18-16(11-14)22-17(24(28-18)13-5-8-15(27)9-6-13)12-21(23(22)26)32-20-4-2-1-3-19(20)29(30)31/h1-11,17,21-24,28H,12H2/t17-,21-,22-,23+,24-/m0/s1 |
| InChIKey | ZFEGTITZQRQEDZ-LVTPPWGZSA-N |
| XLogP | 7.43 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.40 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|