C24H19Cl2N3O4S — CID 3115073
1,8-dichloro-4-(3-nitrophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline (PubChem CID 3115073) has the molecular formula C24H19Cl2N3O4S and a molecular weight of 516.41 g/mol. Its IUPAC name is 1,8-dichloro-4-(3-nitrophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline.
| Compound Name | 1,8-dichloro-4-(3-nitrophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 3115073 |
| Molecular Formula | C24H19Cl2N3O4S |
| Molecular Weight | 516.41 g/mol |
| Exact Mass | 515.05 |
| IUPAC Name | 1,8-dichloro-4-(3-nitrophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline |
| SMILES | O=[N+]([O-])c1cccc(C2Nc3ccc(Cl)cc3C3C(Cl)C(Sc4ccccc4[N+](=O)[O-])CC23)c1 |
| InChI | InChI=1S/C24H19Cl2N3O4S/c25-14-8-9-18-16(11-14)22-17(24(27-18)13-4-3-5-15(10-13)28(30)31)12-21(23(22)26)34-20-7-2-1-6-19(20)29(32)33/h1-11,17,21-24,27H,12H2 |
| InChIKey | LFCGRZVNJLBFCQ-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.41 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|