C31H23Cl2N3O5S — CID 124774657
[(1S,2S,3aR,4S,9bS)-1,8-dichloro-4-(3-nitrophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-6-yl]-phenylmethanone (PubChem CID 124774657) has the molecular formula C31H23Cl2N3O5S and a molecular weight of 620.51 g/mol. Its IUPAC name is [(1S,2S,3aR,4S,9bS)-1,8-dichloro-4-(3-nitrophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-6-yl]-phenylmethanone.
| Compound Name | [(1S,2S,3aR,4S,9bS)-1,8-dichloro-4-(3-nitrophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-6-yl]-phenylmethanone |
|---|---|
| PubChem CID | 124774657 |
| Molecular Formula | C31H23Cl2N3O5S |
| Molecular Weight | 620.51 g/mol |
| Exact Mass | 619.07 |
| IUPAC Name | [(1S,2S,3aR,4S,9bS)-1,8-dichloro-4-(3-nitrophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-6-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1cc(Cl)cc2c1N[C@H](c1cccc([N+](=O)[O-])c1)[C@@H]1C[C@H](Sc3ccccc3[N+](=O)[O-])[C@@H](Cl)[C@H]21 |
| InChI | InChI=1S/C31H23Cl2N3O5S/c32-19-14-21-27-22(16-26(28(27)33)42-25-12-5-4-11-24(25)36(40)41)29(18-9-6-10-20(13-18)35(38)39)34-30(21)23(15-19)31(37)17-7-2-1-3-8-17/h1-15,22,26-29,34H,16H2/t22-,26+,27-,28-,29-/m1/s1 |
| InChIKey | JUUAYDGPGAMICQ-DNQXJSMESA-N |
| XLogP | 8.43 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.51 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|