C25H19BrClN2O4S- — CID 11920107
(1S,2S,3aS,4R,9bR)-4-(3-bromophenyl)-1-chloro-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-6-carboxylate (PubChem CID 11920107) has the molecular formula C25H19BrClN2O4S- and a molecular weight of 558.86 g/mol. Its IUPAC name is (1S,2S,3aS,4R,9bR)-4-(3-bromophenyl)-1-chloro-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-6-carboxylate.
| Compound Name | (1S,2S,3aS,4R,9bR)-4-(3-bromophenyl)-1-chloro-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-6-carboxylate |
|---|---|
| PubChem CID | 11920107 |
| Molecular Formula | C25H19BrClN2O4S- |
| Molecular Weight | 558.86 g/mol |
| Exact Mass | 556.99 |
| IUPAC Name | (1S,2S,3aS,4R,9bR)-4-(3-bromophenyl)-1-chloro-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-6-carboxylate |
| SMILES | O=C([O-])c1cccc2c1N[C@@H](c1cccc(Br)c1)[C@H]1C[C@H](Sc3ccccc3[N+](=O)[O-])[C@@H](Cl)[C@@H]21 |
| InChI | InChI=1S/C25H20BrClN2O4S/c26-14-6-3-5-13(11-14)23-17-12-20(34-19-10-2-1-9-18(19)29(32)33)22(27)21(17)15-7-4-8-16(25(30)31)24(15)28-23/h1-11,17,20-23,28H,12H2,(H,30,31)/p-1/t17-,20-,21-,22+,23-/m0/s1 |
| InChIKey | XAXWAUYMIPGHTD-MEFBHEEYSA-M |
| XLogP | 5.76 |
| TPSA | 95.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.86 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|