C29H27BrClN3O4S — CID 124722608
[(1S,2S,3aR,4S,9bS)-4-(4-bromophenyl)-1-chloro-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-6-yl]-morpholin-4-ylmethanone (PubChem CID 124722608) has the molecular formula C29H27BrClN3O4S and a molecular weight of 628.98 g/mol. Its IUPAC name is [(1S,2S,3aR,4S,9bS)-4-(4-bromophenyl)-1-chloro-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-6-yl]-morpholin-4-ylmethanone.
| Compound Name | [(1S,2S,3aR,4S,9bS)-4-(4-bromophenyl)-1-chloro-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-6-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 124722608 |
| Molecular Formula | C29H27BrClN3O4S |
| Molecular Weight | 628.98 g/mol |
| Exact Mass | 627.06 |
| IUPAC Name | [(1S,2S,3aR,4S,9bS)-4-(4-bromophenyl)-1-chloro-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-6-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1cccc2c1N[C@H](c1ccc(Br)cc1)[C@@H]1C[C@H](Sc3ccccc3[N+](=O)[O-])[C@@H](Cl)[C@H]21)N1CCOCC1 |
| InChI | InChI=1S/C29H27BrClN3O4S/c30-18-10-8-17(9-11-18)27-21-16-24(39-23-7-2-1-6-22(23)34(36)37)26(31)25(21)19-4-3-5-20(28(19)32-27)29(35)33-12-14-38-15-13-33/h1-11,21,24-27,32H,12-16H2/t21-,24+,25-,26-,27-/m1/s1 |
| InChIKey | RPKFLXZAMGAPFG-YWAOTASRSA-N |
| XLogP | 6.87 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.98 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|