C23H23BrN2O2 — CID 40806854
[(3aS,4S,9bS)-4-(4-bromophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-6-yl]-morpholin-4-ylmethanone (PubChem CID 40806854) has the molecular formula C23H23BrN2O2 and a molecular weight of 439.35 g/mol. Its IUPAC name is [(3aS,4S,9bS)-4-(4-bromophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-6-yl]-morpholin-4-ylmethanone.
| Compound Name | [(3aS,4S,9bS)-4-(4-bromophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-6-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 40806854 |
| Molecular Formula | C23H23BrN2O2 |
| Molecular Weight | 439.35 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | [(3aS,4S,9bS)-4-(4-bromophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-6-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1cccc2c1N[C@H](c1ccc(Br)cc1)[C@H]1CC=C[C@H]21)N1CCOCC1 |
| InChI | InChI=1S/C23H23BrN2O2/c24-16-9-7-15(8-10-16)21-18-4-1-3-17(18)19-5-2-6-20(22(19)25-21)23(27)26-11-13-28-14-12-26/h1-3,5-10,17-18,21,25H,4,11-14H2/t17-,18-,21+/m0/s1 |
| InChIKey | PQWMZFKKGXLRIV-BBTUJRGHSA-N |
| XLogP | 4.75 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.35 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|