C23H22Cl2N2O2 — CID 41316057
[(3aR,4S,9bS)-4-(2,4-dichlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-6-yl]-morpholin-4-ylmethanone (PubChem CID 41316057) has the molecular formula C23H22Cl2N2O2 and a molecular weight of 429.35 g/mol. Its IUPAC name is [(3aR,4S,9bS)-4-(2,4-dichlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-6-yl]-morpholin-4-ylmethanone.
| Compound Name | [(3aR,4S,9bS)-4-(2,4-dichlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-6-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 41316057 |
| Molecular Formula | C23H22Cl2N2O2 |
| Molecular Weight | 429.35 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | [(3aR,4S,9bS)-4-(2,4-dichlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-6-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1cccc2c1N[C@H](c1ccc(Cl)cc1Cl)[C@@H]1CC=C[C@H]21)N1CCOCC1 |
| InChI | InChI=1S/C23H22Cl2N2O2/c24-14-7-8-18(20(25)13-14)21-16-4-1-3-15(16)17-5-2-6-19(22(17)26-21)23(28)27-9-11-29-12-10-27/h1-3,5-8,13,15-16,21,26H,4,9-12H2/t15-,16+,21-/m0/s1 |
| InChIKey | MZXBRFVCLOJESL-MRUHUIDDSA-N |
| XLogP | 5.29 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.35 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|