C24H26ClN3O — CID 17239542
[4-(2-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-6-yl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 17239542) has the molecular formula C24H26ClN3O and a molecular weight of 407.95 g/mol. Its IUPAC name is [4-(2-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-6-yl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [4-(2-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-6-yl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 17239542 |
| Molecular Formula | C24H26ClN3O |
| Molecular Weight | 407.95 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | [4-(2-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-6-yl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)c2cccc3c2NC(c2ccccc2Cl)C2CC=CC32)CC1 |
| InChI | InChI=1S/C24H26ClN3O/c1-27-12-14-28(15-13-27)24(29)20-10-5-9-18-16-7-4-8-17(16)22(26-23(18)20)19-6-2-3-11-21(19)25/h2-7,9-11,16-17,22,26H,8,12-15H2,1H3 |
| InChIKey | WKJNVPDGESRTNF-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.95 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|