C19H17Cl2N — CID 29122103
(3aR,4S,9bR)-7-chloro-4-(2-chlorophenyl)-6-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 29122103) has the molecular formula C19H17Cl2N and a molecular weight of 330.26 g/mol. Its IUPAC name is (3aR,4S,9bR)-7-chloro-4-(2-chlorophenyl)-6-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (3aR,4S,9bR)-7-chloro-4-(2-chlorophenyl)-6-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 29122103 |
| Molecular Formula | C19H17Cl2N |
| Molecular Weight | 330.26 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | (3aR,4S,9bR)-7-chloro-4-(2-chlorophenyl)-6-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | Cc1c(Cl)ccc2c1N[C@H](c1ccccc1Cl)[C@@H]1CC=C[C@@H]21 |
| InChI | InChI=1S/C19H17Cl2N/c1-11-16(20)10-9-14-12-6-4-7-13(12)19(22-18(11)14)15-5-2-3-8-17(15)21/h2-6,8-10,12-13,19,22H,7H2,1H3/t12-,13-,19+/m1/s1 |
| InChIKey | SOWPDFUJTZCUGX-VPZZIHKRSA-N |
| XLogP | 6.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.26 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|