C18H14Cl3N — CID 6973768
(3aR,4S,9bR)-6-chloro-4-(2,3-dichlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 6973768) has the molecular formula C18H14Cl3N and a molecular weight of 350.68 g/mol. Its IUPAC name is (3aR,4S,9bR)-6-chloro-4-(2,3-dichlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (3aR,4S,9bR)-6-chloro-4-(2,3-dichlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 6973768 |
| Molecular Formula | C18H14Cl3N |
| Molecular Weight | 350.68 g/mol |
| Exact Mass | 349.02 |
| IUPAC Name | (3aR,4S,9bR)-6-chloro-4-(2,3-dichlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | Clc1cccc([C@H]2Nc3c(Cl)cccc3[C@@H]3C=CC[C@@H]23)c1Cl |
| InChI | InChI=1S/C18H14Cl3N/c19-14-8-3-7-13(16(14)21)17-11-5-1-4-10(11)12-6-2-9-15(20)18(12)22-17/h1-4,6-11,17,22H,5H2/t10-,11-,17+/m1/s1 |
| InChIKey | JVLQZBOFIWWNPJ-AGKHESDQSA-N |
| XLogP | 6.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.68 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|