C19H14Cl2N2 — CID 92847075
(3aR,4S,9bR)-4-(2,3-dichlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carbonitrile (PubChem CID 92847075) has the molecular formula C19H14Cl2N2 and a molecular weight of 341.24 g/mol. Its IUPAC name is (3aR,4S,9bR)-4-(2,3-dichlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carbonitrile.
| Compound Name | (3aR,4S,9bR)-4-(2,3-dichlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carbonitrile |
|---|---|
| PubChem CID | 92847075 |
| Molecular Formula | C19H14Cl2N2 |
| Molecular Weight | 341.24 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | (3aR,4S,9bR)-4-(2,3-dichlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carbonitrile |
| SMILES | N#Cc1cccc2c1N[C@H](c1cccc(Cl)c1Cl)[C@@H]1CC=C[C@@H]21 |
| InChI | InChI=1S/C19H14Cl2N2/c20-16-9-3-8-15(17(16)21)19-14-7-2-5-12(14)13-6-1-4-11(10-22)18(13)23-19/h1-6,8-9,12,14,19,23H,7H2/t12-,14+,19-/m0/s1 |
| InChIKey | AKZIBHBZJUMNBD-CFZJUORYSA-N |
| XLogP | 5.69 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.24 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|