C19H17Cl2NOS — CID 166319667
4-(2,3-dichlorophenyl)-6-methylsulfinyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 166319667) has the molecular formula C19H17Cl2NOS and a molecular weight of 378.32 g/mol. Its IUPAC name is 4-(2,3-dichlorophenyl)-6-methylsulfinyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | 4-(2,3-dichlorophenyl)-6-methylsulfinyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 166319667 |
| Molecular Formula | C19H17Cl2NOS |
| Molecular Weight | 378.32 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | 4-(2,3-dichlorophenyl)-6-methylsulfinyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | CS(=O)c1cccc2c1NC(c1cccc(Cl)c1Cl)C1CC=CC21 |
| InChI | InChI=1S/C19H17Cl2NOS/c1-24(23)16-10-4-7-13-11-5-2-6-12(11)18(22-19(13)16)14-8-3-9-15(20)17(14)21/h2-5,7-12,18,22H,6H2,1H3 |
| InChIKey | OWWSWRROIQAZBP-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.32 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|