C25H28N2O3 — CID 17236791
azepan-1-yl-[4-(2,4-dihydroxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-6-yl]methanone (PubChem CID 17236791) has the molecular formula C25H28N2O3 and a molecular weight of 404.51 g/mol. Its IUPAC name is azepan-1-yl-[4-(2,4-dihydroxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-6-yl]methanone.
| Compound Name | azepan-1-yl-[4-(2,4-dihydroxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-6-yl]methanone |
|---|---|
| PubChem CID | 17236791 |
| Molecular Formula | C25H28N2O3 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | azepan-1-yl-[4-(2,4-dihydroxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-6-yl]methanone |
| SMILES | O=C(c1cccc2c1NC(c1ccc(O)cc1O)C1CC=CC21)N1CCCCCC1 |
| InChI | InChI=1S/C25H28N2O3/c28-16-11-12-20(22(29)15-16)23-18-8-5-7-17(18)19-9-6-10-21(24(19)26-23)25(30)27-13-3-1-2-4-14-27/h5-7,9-12,15,17-18,23,26,28-29H,1-4,8,13-14H2 |
| InChIKey | DPAPQGTWMHAMHI-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|