C24H25ClN2O — CID 17239395
[4-(4-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-6-yl]-piperidin-1-ylmethanone (PubChem CID 17239395) has the molecular formula C24H25ClN2O and a molecular weight of 392.93 g/mol. Its IUPAC name is [4-(4-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-6-yl]-piperidin-1-ylmethanone.
| Compound Name | [4-(4-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-6-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 17239395 |
| Molecular Formula | C24H25ClN2O |
| Molecular Weight | 392.93 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | [4-(4-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-6-yl]-piperidin-1-ylmethanone |
| SMILES | O=C(c1cccc2c1NC(c1ccc(Cl)cc1)C1CC=CC21)N1CCCCC1 |
| InChI | InChI=1S/C24H25ClN2O/c25-17-12-10-16(11-13-17)22-19-7-4-6-18(19)20-8-5-9-21(23(20)26-22)24(28)27-14-2-1-3-15-27/h4-6,8-13,18-19,22,26H,1-3,7,14-15H2 |
| InChIKey | ISNHAPAINLHNHT-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.93 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|