C26H30N2O2 — CID 17239095
morpholin-4-yl-[4-(4-propan-2-ylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-6-yl]methanone (PubChem CID 17239095) has the molecular formula C26H30N2O2 and a molecular weight of 402.54 g/mol. Its IUPAC name is morpholin-4-yl-[4-(4-propan-2-ylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-6-yl]methanone.
| Compound Name | morpholin-4-yl-[4-(4-propan-2-ylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-6-yl]methanone |
|---|---|
| PubChem CID | 17239095 |
| Molecular Formula | C26H30N2O2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | morpholin-4-yl-[4-(4-propan-2-ylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-6-yl]methanone |
| SMILES | CC(C)c1ccc(C2Nc3c(C(=O)N4CCOCC4)cccc3C3C=CCC32)cc1 |
| InChI | InChI=1S/C26H30N2O2/c1-17(2)18-9-11-19(12-10-18)24-21-6-3-5-20(21)22-7-4-8-23(25(22)27-24)26(29)28-13-15-30-16-14-28/h3-5,7-12,17,20-21,24,27H,6,13-16H2,1-2H3 |
| InChIKey | GRLPFYJDHIHMFO-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|