C23H25NO2 — CID 1280651
(3aR,4S,9bS)-6-methyl-4-(4-propan-2-ylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-7-carboxylic acid (PubChem CID 1280651) has the molecular formula C23H25NO2 and a molecular weight of 347.46 g/mol. Its IUPAC name is (3aR,4S,9bS)-6-methyl-4-(4-propan-2-ylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-7-carboxylic acid.
| Compound Name | (3aR,4S,9bS)-6-methyl-4-(4-propan-2-ylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-7-carboxylic acid |
|---|---|
| PubChem CID | 1280651 |
| Molecular Formula | C23H25NO2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | (3aR,4S,9bS)-6-methyl-4-(4-propan-2-ylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-7-carboxylic acid |
| SMILES | Cc1c(C(=O)O)ccc2c1N[C@H](c1ccc(C(C)C)cc1)[C@@H]1CC=C[C@H]21 |
| InChI | InChI=1S/C23H25NO2/c1-13(2)15-7-9-16(10-8-15)22-19-6-4-5-18(19)20-12-11-17(23(25)26)14(3)21(20)24-22/h4-5,7-13,18-19,22,24H,6H2,1-3H3,(H,25,26)/t18-,19+,22+/m0/s1 |
| InChIKey | ORPLRCWQJZYHQC-NNMXDRDESA-N |
| XLogP | 5.64 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|