C21H18F3NO2 — CID 7366836
(3aR,4R,9bR)-6-methyl-4-[3-(trifluoromethyl)phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-7-carboxylic acid (PubChem CID 7366836) has the molecular formula C21H18F3NO2 and a molecular weight of 373.37 g/mol. Its IUPAC name is (3aR,4R,9bR)-6-methyl-4-[3-(trifluoromethyl)phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-7-carboxylic acid.
| Compound Name | (3aR,4R,9bR)-6-methyl-4-[3-(trifluoromethyl)phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-7-carboxylic acid |
|---|---|
| PubChem CID | 7366836 |
| Molecular Formula | C21H18F3NO2 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | (3aR,4R,9bR)-6-methyl-4-[3-(trifluoromethyl)phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-7-carboxylic acid |
| SMILES | Cc1c(C(=O)O)ccc2c1N[C@@H](c1cccc(C(F)(F)F)c1)[C@@H]1CC=C[C@@H]21 |
| InChI | InChI=1S/C21H18F3NO2/c1-11-14(20(26)27)8-9-17-15-6-3-7-16(15)19(25-18(11)17)12-4-2-5-13(10-12)21(22,23)24/h2-6,8-10,15-16,19,25H,7H2,1H3,(H,26,27)/t15-,16-,19+/m1/s1 |
| InChIKey | OBZCGXZLOPIXLW-MDZRGWNJSA-N |
| XLogP | 5.54 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|