C20H20ClN — CID 29120341
(3aR,4S,9bR)-4-(3-chlorophenyl)-6,7-dimethyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 29120341) has the molecular formula C20H20ClN and a molecular weight of 309.84 g/mol. Its IUPAC name is (3aR,4S,9bR)-4-(3-chlorophenyl)-6,7-dimethyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (3aR,4S,9bR)-4-(3-chlorophenyl)-6,7-dimethyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 29120341 |
| Molecular Formula | C20H20ClN |
| Molecular Weight | 309.84 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | (3aR,4S,9bR)-4-(3-chlorophenyl)-6,7-dimethyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | Cc1ccc2c(c1C)N[C@H](c1cccc(Cl)c1)[C@@H]1CC=C[C@@H]21 |
| InChI | InChI=1S/C20H20ClN/c1-12-9-10-18-16-7-4-8-17(16)20(22-19(18)13(12)2)14-5-3-6-15(21)11-14/h3-7,9-11,16-17,20,22H,8H2,1-2H3/t16-,17-,20-/m1/s1 |
| InChIKey | OHSZGERTUVAVND-MBOZVWFJSA-N |
| XLogP | 5.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.84 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|