C20H19Cl2N — CID 17241428
4-(2,4-dichlorophenyl)-6,7-dimethyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 17241428) has the molecular formula C20H19Cl2N and a molecular weight of 344.29 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-6,7-dimethyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | 4-(2,4-dichlorophenyl)-6,7-dimethyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 17241428 |
| Molecular Formula | C20H19Cl2N |
| Molecular Weight | 344.29 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-6,7-dimethyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | Cc1ccc2c(c1C)NC(c1ccc(Cl)cc1Cl)C1CC=CC21 |
| InChI | InChI=1S/C20H19Cl2N/c1-11-6-8-16-14-4-3-5-15(14)20(23-19(16)12(11)2)17-9-7-13(21)10-18(17)22/h3-4,6-10,14-15,20,23H,5H2,1-2H3 |
| InChIKey | IWIVLVYUCDDUMZ-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.29 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|