C22H26N2 — CID 17237251
4-(6,7-dimethyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)-N,N-dimethylaniline (PubChem CID 17237251) has the molecular formula C22H26N2 and a molecular weight of 318.46 g/mol. Its IUPAC name is 4-(6,7-dimethyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)-N,N-dimethylaniline.
| Compound Name | 4-(6,7-dimethyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 17237251 |
| Molecular Formula | C22H26N2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | 4-(6,7-dimethyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)-N,N-dimethylaniline |
| SMILES | Cc1ccc2c(c1C)NC(c1ccc(N(C)C)cc1)C1CC=CC21 |
| InChI | InChI=1S/C22H26N2/c1-14-8-13-20-18-6-5-7-19(18)22(23-21(20)15(14)2)16-9-11-17(12-10-16)24(3)4/h5-6,8-13,18-19,22-23H,7H2,1-4H3 |
| InChIKey | SJWYIWPOWKLJFW-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|