C24H30N2O — CID 17237304
N,N-dimethyl-4-[6-(2-methylpropoxy)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]aniline (PubChem CID 17237304) has the molecular formula C24H30N2O and a molecular weight of 362.52 g/mol. Its IUPAC name is N,N-dimethyl-4-[6-(2-methylpropoxy)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]aniline.
| Compound Name | N,N-dimethyl-4-[6-(2-methylpropoxy)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]aniline |
|---|---|
| PubChem CID | 17237304 |
| Molecular Formula | C24H30N2O |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | N,N-dimethyl-4-[6-(2-methylpropoxy)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]aniline |
| SMILES | CC(C)COc1cccc2c1NC(c1ccc(N(C)C)cc1)C1CC=CC21 |
| InChI | InChI=1S/C24H30N2O/c1-16(2)15-27-22-10-6-9-21-19-7-5-8-20(19)23(25-24(21)22)17-11-13-18(14-12-17)26(3)4/h5-7,9-14,16,19-20,23,25H,8,15H2,1-4H3 |
| InChIKey | METVPSDTCMCLGR-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|