C20H20BrNO — CID 126161447
(3aR,4S,9bR)-4-(3-bromophenyl)-6-ethoxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 126161447) has the molecular formula C20H20BrNO and a molecular weight of 370.29 g/mol. Its IUPAC name is (3aR,4S,9bR)-4-(3-bromophenyl)-6-ethoxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (3aR,4S,9bR)-4-(3-bromophenyl)-6-ethoxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 126161447 |
| Molecular Formula | C20H20BrNO |
| Molecular Weight | 370.29 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | (3aR,4S,9bR)-4-(3-bromophenyl)-6-ethoxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | CCOc1cccc2c1N[C@H](c1cccc(Br)c1)[C@@H]1CC=C[C@@H]21 |
| InChI | InChI=1S/C20H20BrNO/c1-2-23-18-11-5-10-17-15-8-4-9-16(15)19(22-20(17)18)13-6-3-7-14(21)12-13/h3-8,10-12,15-16,19,22H,2,9H2,1H3/t15-,16-,19-/m1/s1 |
| InChIKey | CIYZEXHMWSMHBL-GPMSIDNRSA-N |
| XLogP | 5.67 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.29 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|