C18H15BrFN — CID 21215682
(4S)-4-(3-bromophenyl)-6-fluoro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 21215682) has the molecular formula C18H15BrFN and a molecular weight of 344.23 g/mol. Its IUPAC name is (4S)-4-(3-bromophenyl)-6-fluoro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (4S)-4-(3-bromophenyl)-6-fluoro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 21215682 |
| Molecular Formula | C18H15BrFN |
| Molecular Weight | 344.23 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | (4S)-4-(3-bromophenyl)-6-fluoro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | Fc1cccc2c1N[C@H](c1cccc(Br)c1)C1CC=CC21 |
| InChI | InChI=1S/C18H15BrFN/c19-12-5-1-4-11(10-12)17-14-7-2-6-13(14)15-8-3-9-16(20)18(15)21-17/h1-6,8-10,13-14,17,21H,7H2/t13?,14?,17-/m1/s1 |
| InChIKey | UTTKTVCBGPKFFE-MQBCKMQZSA-N |
| XLogP | 5.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.23 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|