C23H25NO4 — CID 17239852
[4-(6-ethoxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)-2-methoxyphenyl] acetate (PubChem CID 17239852) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is [4-(6-ethoxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)-2-methoxyphenyl] acetate.
| Compound Name | [4-(6-ethoxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 17239852 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | [4-(6-ethoxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)-2-methoxyphenyl] acetate |
| SMILES | CCOc1cccc2c1NC(c1ccc(OC(C)=O)c(OC)c1)C1CC=CC21 |
| InChI | InChI=1S/C23H25NO4/c1-4-27-20-10-6-9-18-16-7-5-8-17(16)22(24-23(18)20)15-11-12-19(28-14(2)25)21(13-15)26-3/h5-7,9-13,16-17,22,24H,4,8H2,1-3H3 |
| InChIKey | UPAWCJAQFLKXJU-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|