C22H22N2O5 — CID 17239817
[2-methoxy-4-(6-methyl-7-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)phenyl] acetate (PubChem CID 17239817) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is [2-methoxy-4-(6-methyl-7-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)phenyl] acetate.
| Compound Name | [2-methoxy-4-(6-methyl-7-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)phenyl] acetate |
|---|---|
| PubChem CID | 17239817 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | [2-methoxy-4-(6-methyl-7-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)phenyl] acetate |
| SMILES | COc1cc(C2Nc3c(ccc([N+](=O)[O-])c3C)C3C=CCC32)ccc1OC(C)=O |
| InChI | InChI=1S/C22H22N2O5/c1-12-18(24(26)27)9-8-17-15-5-4-6-16(15)22(23-21(12)17)14-7-10-19(29-13(2)25)20(11-14)28-3/h4-5,7-11,15-16,22-23H,6H2,1-3H3 |
| InChIKey | FCYCVKJDWXQVFU-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|