C20H18NO3- — CID 11859312
4-[(3aR,4S,9bS)-6-methoxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoate (PubChem CID 11859312) has the molecular formula C20H18NO3- and a molecular weight of 320.37 g/mol. Its IUPAC name is 4-[(3aR,4S,9bS)-6-methoxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoate.
| Compound Name | 4-[(3aR,4S,9bS)-6-methoxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoate |
|---|---|
| PubChem CID | 11859312 |
| Molecular Formula | C20H18NO3- |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 4-[(3aR,4S,9bS)-6-methoxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoate |
| SMILES | COc1cccc2c1N[C@H](c1ccc(C(=O)[O-])cc1)[C@@H]1CC=C[C@H]21 |
| InChI | InChI=1S/C20H19NO3/c1-24-17-7-3-6-16-14-4-2-5-15(14)18(21-19(16)17)12-8-10-13(11-9-12)20(22)23/h2-4,6-11,14-15,18,21H,5H2,1H3,(H,22,23)/p-1/t14-,15+,18+/m0/s1 |
| InChIKey | IPNOZTJAHBNSAK-HDMKZQKVSA-M |
| XLogP | 2.89 |
| TPSA | 61.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|