C21H20NO3- — CID 7111504
4-[(3aS,4R,9bR)-6-methoxy-9-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoate (PubChem CID 7111504) has the molecular formula C21H20NO3- and a molecular weight of 334.40 g/mol. Its IUPAC name is 4-[(3aS,4R,9bR)-6-methoxy-9-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoate.
| Compound Name | 4-[(3aS,4R,9bR)-6-methoxy-9-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoate |
|---|---|
| PubChem CID | 7111504 |
| Molecular Formula | C21H20NO3- |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 4-[(3aS,4R,9bR)-6-methoxy-9-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoate |
| SMILES | COc1ccc(C)c2c1N[C@@H](c1ccc(C(=O)[O-])cc1)[C@H]1CC=C[C@@H]21 |
| InChI | InChI=1S/C21H21NO3/c1-12-6-11-17(25-2)20-18(12)15-4-3-5-16(15)19(22-20)13-7-9-14(10-8-13)21(23)24/h3-4,6-11,15-16,19,22H,5H2,1-2H3,(H,23,24)/p-1/t15-,16+,19+/m1/s1 |
| InChIKey | RIIOHIUWEGYOJT-GJYPPUQNSA-M |
| XLogP | 3.19 |
| TPSA | 61.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|