C20H18NO2- — CID 11904155
4-[(3aS,4R,9bS)-6-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoate (PubChem CID 11904155) has the molecular formula C20H18NO2- and a molecular weight of 304.37 g/mol. Its IUPAC name is 4-[(3aS,4R,9bS)-6-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoate.
| Compound Name | 4-[(3aS,4R,9bS)-6-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoate |
|---|---|
| PubChem CID | 11904155 |
| Molecular Formula | C20H18NO2- |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 4-[(3aS,4R,9bS)-6-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoate |
| SMILES | Cc1cccc2c1N[C@@H](c1ccc(C(=O)[O-])cc1)[C@H]1CC=C[C@H]21 |
| InChI | InChI=1S/C20H19NO2/c1-12-4-2-6-16-15-5-3-7-17(15)19(21-18(12)16)13-8-10-14(11-9-13)20(22)23/h2-6,8-11,15,17,19,21H,7H2,1H3,(H,22,23)/p-1/t15-,17+,19+/m1/s1 |
| InChIKey | SCALKYQRNSCLNJ-AYBZRNKSSA-M |
| XLogP | 3.19 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|