C21H18NO4- — CID 4659873
4-(6-methoxycarbonyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)benzoate (PubChem CID 4659873) has the molecular formula C21H18NO4- and a molecular weight of 348.38 g/mol. Its IUPAC name is 4-(6-methoxycarbonyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)benzoate.
| Compound Name | 4-(6-methoxycarbonyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)benzoate |
|---|---|
| PubChem CID | 4659873 |
| Molecular Formula | C21H18NO4- |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 4-(6-methoxycarbonyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)benzoate |
| SMILES | COC(=O)c1cccc2c1NC(c1ccc(C(=O)[O-])cc1)C1CC=CC21 |
| InChI | InChI=1S/C21H19NO4/c1-26-21(25)17-7-3-6-16-14-4-2-5-15(14)18(22-19(16)17)12-8-10-13(11-9-12)20(23)24/h2-4,6-11,14-15,18,22H,5H2,1H3,(H,23,24)/p-1 |
| InChIKey | AWLTWPHKRLCZJX-UHFFFAOYSA-M |
| XLogP | 2.66 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|